Home
Products
Guaiazulene
| Product Name | Guaiazulene |
| Price: | Inquiry |
| Catalog No.: | CN09044 |
| CAS No.: | 489-84-9 |
| Molecular Formula: | C15H18 |
| Molecular Weight: | 198.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | From Euplexaura erecta. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(c1ccc(c2c(c1)c(C)cc2)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Guaiazulene is present in several essential oils of medicinal and aromatic plants, with antioxidant activity. Guaiazulene has in vitro cytotoxic activity against neuron and N2a neuroblastom (N2a-NB) cells[1][2]. |
| Density | 0.976 |
| Boiling Point | 305.4±22.0 °C at 760 mmHg |
| Flash Point | 142.3±13.1 °C |
| Exact Mass | 198.140854 |
| LogP | 5.71 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |