Home
Products
Globulol
| Product Name | Globulol |
| Price: | Inquiry |
| Catalog No.: | CN09245 |
| CAS No.: | 489-41-8 |
| Molecular Formula: | C15H26O |
| Molecular Weight: | 222.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Eucalyptus globulus Labill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@@H]2[C@@H]1[C@H]1[C@H](C1(C)C)CC[C@@]2(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 0.962g/cm3 |
| Boiling Point | 283ºC |
| Flash Point | 123.1ºC |
| Exact Mass | 222.19800 |
| PSA | 20.23000 |
| LogP | 3.46570 |
| Vapour Pressure | 0.000177mmHg at 25°C |