Home
Products
(-)-Eburnamonine
| Product Name | (-)-Eburnamonine |
| Price: | Inquiry |
| Catalog No.: | CN00571 |
| CAS No.: | 4880-88-0 |
| Molecular Formula: | C19H22N2O |
| Molecular Weight: | 294.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Catharanthus roseus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@]12CCCN3[C@]2(C)c2n(C(=O)C1)c1c(c2CC3)cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vincamone is a vinca alkaloid and a metabolite of vincamine, is a vasodilator. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 441.9±33.0 °C at 760 mmHg |
| Flash Point | 221.0±25.4 °C |
| Exact Mass | 294.173218 |
| PSA | 25.24000 |
| LogP | 3.79 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | -20℃ |