Home
Products
D-arabinitol
| Product Name | D-arabinitol |
| Price: | Inquiry |
| Catalog No.: | CN06658 |
| CAS No.: | 488-82-4 |
| Molecular Formula: | C5H12O5 |
| Molecular Weight: | 152.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Cryst. |
| Source: | The barks of Eucommia ulmoides Oliver |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]([C@H]([C@@H](CO)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Arabinitol, D- is a polyol and its accumulation may cause a neurotoxic effect in human. |
| Target | Human Endogenous Metabolite |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 494.5±40.0 °C at 760 mmHg |
| Flash Point | 261.9±21.9 °C |
| Exact Mass | 152.068466 |
| PSA | 101.15000 |
| LogP | -3.77 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | Refrigerator (+4°C) |