Home
Products
vibo-Quercitol
| Product Name | vibo-Quercitol |
| Price: | Inquiry |
| Catalog No.: | CN06659 |
| CAS No.: | 488-76-6 |
| Molecular Formula: | C6H12O5 |
| Molecular Weight: | 164.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Itea yunnanensis Franch. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1C[C@@H](O)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 293.6±40.0 °C at 760 mmHg |
| Flash Point | 146.2±21.9 °C |
| Exact Mass | 164.068466 |
| PSA | 101.15000 |
| LogP | -1.67 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |