Home
Products
Hypaphorine
| Product Name | Hypaphorine |
| Price: | $161 / 10mg |
| Catalog No.: | CN01089 |
| CAS No.: | 487-58-1 |
| Molecular Formula: | C14H18N2O2 |
| Molecular Weight: | 246.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Erythrina variegata L. |
| Solvent: | PBS, Water, Methanol, Ethanol, DMSO, Pyridine, etc. |
| SMILES: | [O-]C(=O)C([N+](C)(C)C)Cc1c[nH]c2c1cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hypaphorine is an indole alkaloid isolated from Pisolithus tinctorius, and with neurological and glucose-lowering effects in rodents[1]. |
| Exact Mass | 246.136826 |
| PSA | 55.92000 |
| LogP | -2.12 |
| Storage condition | 2-8℃ |