Home
Products
Pinoresinol
| Product Name | Pinoresinol |
| Price: | $92 / 10mg |
| Catalog No.: | CN02938 |
| CAS No.: | 487-36-5 |
| Molecular Formula: | C20H22O6 |
| Molecular Weight: | 358.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The barks of Eucommia ulmoides Oliver. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)[C@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pinoresinol is a lignol of plant origin serving for defense in a caterpillar. Pinoresinol drastically sensitizes cancer cells against TNF-related apoptosis-inducing ligand (TRAIL) -induced apoptosis[1][2]. |
| In Vitro | Pinoresinol facilitated death-inducing signaling complex formation to trigger a caspase-8-dependent apoptotic cascade activation in TRAIL-resistant glioblastoma cells[2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 556.5±50.0 °C at 760 mmHg |
| Flash Point | 290.4±30.1 °C |
| Exact Mass | 358.141632 |
| PSA | 77.38000 |
| LogP | 1.54 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | ?20°C |