Home
Products
Scopoline
| Product Name | Scopoline |
| Price: | Inquiry |
| Catalog No.: | CN01681 |
| CAS No.: | 487-27-4 |
| Molecular Formula: | C8H13NO2 |
| Molecular Weight: | 155.20 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Oil |
| Source: | The herbs of Atropa belladonna. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CN1[C@H]2CC3C[C@H]1[C@@H]([C@H]2O)O3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Scopoline (compound 3a) is a compound easily formed from scopine[1]. |
| Density | 1.284 g/cm3 |
| Boiling Point | 248ºCat 760 mmHg |
| Flash Point | 111.6ºC |
| Exact Mass | 155.09500 |
| PSA | 32.70000 |
| Vapour Pressure | 0.00403mmHg at 25°C |