Home
Products
7-Hydroxy-4'-methoxyflavone
| Product Name | 7-Hydroxy-4'-methoxyflavone |
| Price: | $293 / 10mg |
| Catalog No.: | CN04335 |
| CAS No.: | 487-24-1 |
| Molecular Formula: | C16H12O4 |
| Molecular Weight: | 268.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Edgeworthia gardneri |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(cc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.329g/cm3 |
| Boiling Point | 479.4ºC at 760mmHg |
| Flash Point | 183.4ºC |
| Exact Mass | 266.09400 |
| PSA | 39.44000 |
| LogP | 3.77700 |
| Vapour Pressure | 8.17E-10mmHg at 25°C |