Home
Products
Citropten
| Product Name | Citropten |
| Price: | $43 / 20mg |
| Catalog No.: | CN06157 |
| CAS No.: | 487-06-9 |
| Molecular Formula: | C11H10O4 |
| Molecular Weight: | 206.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The peels of Citrus medica L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(OC)c2c(c1)oc(=O)cc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Citropten (5,7-Dimethoxycoumarin) is a coumarin isolated from bergamot oil. Citropten (5,7-Dimethoxycoumarin) has an antiproliferative activity against A2058 human melanoma cell line[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 388.1±42.0 °C at 760 mmHg |
| Flash Point | 176.3±27.9 °C |
| Exact Mass | 206.057907 |
| PSA | 48.67000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Storage condition | 2-8°C |