Home
Products
Harmol
| Product Name | Harmol |
| Price: | $117 / 20mg |
| Catalog No.: | CN00101 |
| CAS No.: | 487-03-6 |
| Molecular Formula: | C12H10N2O |
| Molecular Weight: | 198.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rauvolfia verticillata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)[nH]c1c2ccnc1C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Harmol categorized as a β-carboline alkaloid. Harmol is a potent MAO inhibitor used as an analytical reference standard[1]. |
| Density | 1.33g/cm3 |
| Boiling Point | 552.7ºC at 760mmHg |
| Flash Point | 255ºC |
| Exact Mass | 198.07900 |
| PSA | 48.91000 |
| LogP | 2.73010 |
| Vapour Pressure | 0mmHg at 25°C |