Home
Products
Thermopsine
| Product Name | Thermopsine |
| Price: | $190 / 10mg |
| Catalog No.: | CN01289 |
| CAS No.: | 486-90-8 |
| Molecular Formula: | C15H20N2O |
| Molecular Weight: | 244.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Thermopsis turkestanica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1cccc2n1C[C@H]1C[C@@H]2CN2[C@H]1CCCC2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Thermopsine is a quinolizidine alkaloid isolated from the fruits and pods and stem bark of Sophora velutina subsp. Thermopsine has antibacterial activity[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 455.6±34.0 °C at 760 mmHg |
| Flash Point | 216.3±18.0 °C |
| Exact Mass | 244.157562 |
| PSA | 25.24000 |
| LogP | 1.65 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |