Home
Products
Lupinine
| Product Name | Lupinine |
| Price: | Inquiry |
| Catalog No.: | CN00597 |
| CAS No.: | 486-70-4 |
| Molecular Formula: | C10H19NO |
| Molecular Weight: | 169.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The seeds of Lupinus luteus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@H]1CCCN2[C@@H]1CCCC2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Lupinine is a quinolizidine alkaloid. |
| Density | 1.04 g/cm3 |
| Boiling Point | 160-164°C 4mm |
| Flash Point | 160-164°C/4mm |
| Exact Mass | 169.14700 |
| PSA | 23.47000 |
| LogP | 1.18110 |
| Vapour Pressure | 0.000928mmHg at 25°C |