Home
Products
Ononin
| Product Name | Ononin |
| Price: | $77 / 20mg |
| Catalog No.: | CN05551 |
| CAS No.: | 486-62-4 |
| Molecular Formula: | C22H22O9 |
| Molecular Weight: | 430.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ononis natrix L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc3c(c2)occ(c3=O)c2ccc(cc2)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ononin is an isoflavonoid, is an additional growth inhibitor in soils associated with the weed, Pluchea lanceolata. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 697.8±55.0 °C at 760 mmHg |
| Flash Point | 245.7±25.0 °C |
| Exact Mass | 430.126373 |
| PSA | 138.82000 |
| LogP | 0.63 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |