Home
Products
Coclaurine
| Product Name | Coclaurine |
| Price: | $139 / 10mg |
| Catalog No.: | CN01964 |
| CAS No.: | 486-39-5 |
| Molecular Formula: | C17H19NO3 |
| Molecular Weight: | 285.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Coptis chinensis Franch |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCNC(c2cc1O)Cc1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Coclaurine is a class of tetrahydroisoquinoline alkaloids isolated from Sarcopetalum harveyanum. Coclaurine is a nicotinic acetylcholine receptor (nAChRs) antagonist[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 496.9±45.0 °C at 760 mmHg |
| Flash Point | 254.3±28.7 °C |
| Exact Mass | 285.136505 |
| PSA | 61.72000 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |