Home
Products
Fraxinol
| Product Name | Fraxinol |
| Price: | Inquiry |
| Catalog No.: | CN06257 |
| CAS No.: | 486-28-2 |
| Molecular Formula: | C11H10O5 |
| Molecular Weight: | 222.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Fraxinus Lobelia chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2oc(=O)ccc2c(c1O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Fraxinol is isolated from Lobelia chinensis[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 449.7±45.0 °C at 760 mmHg |
| Flash Point | 182.1±22.2 °C |
| Exact Mass | 222.052826 |
| PSA | 68.90000 |
| LogP | 0.90 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |