Home
Products
Isofraxidin
| Product Name | Isofraxidin |
| Price: | Inquiry |
| Catalog No.: | CN06214 |
| CAS No.: | 486-21-5 |
| Molecular Formula: | C11H10O5 |
| Molecular Weight: | 222.19 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Sarcandra glabra (Thunb.) Nakai |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)c(OC)cc2c1oc(=O)cc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isofraxidin, a coumarin component from Acanthopanax senticosus, inhibits MMP-7 expression and cell invasion of human hepatoma cells. Isofraxidin inhibits the phosphorylation of ERK1/2 in hepatoma cells[1]. Isofraxidin attenuates the expression of iNOS and COX-2, Isofraxidinalso inhibits TLR4/myeloid differentiation protein-2 (MD-2) complex formation[2]. |
| Target | COX-2 TLR4 MMP-7 |
| In Vitro | Isofraxidin inhibits expression of MMP-7 and in vitro cell invasion at a non-toxic level through inhibiting ERK1/2 phosphorylation in hepatoma cell lines[1]. Isofraxidin competitively inhibits TLR4/MD-2 complex formation, and thus TLR4/NF-κB signalling cascades.Isofraxidin has potential in the treatment of Osteoarthritis (OA)[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 452.1±45.0 °C at 760 mmHg |
| Flash Point | 183.2±22.2 °C |
| Exact Mass | 222.052826 |
| PSA | 68.90000 |
| LogP | 1.31 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | ?20°C |