Home
Products
(+)-Dihydrocinchonine
| Product Name | (+)-Dihydrocinchonine |
| Price: | Inquiry |
| Catalog No.: | CN00593 |
| CAS No.: | 485-65-4 |
| Molecular Formula: | C19H24N2O |
| Molecular Weight: | 296.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Cinchona ledgeriana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](c1ccnc2c1cccc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.18 g/cm3 |
| Boiling Point | 467.1ºC at 760 mmHg |
| Flash Point | 236.3ºC |
| Exact Mass | 296.18900 |
| PSA | 36.36000 |
| LogP | 3.32650 |
| Vapour Pressure | 0mmHg at 25°C |