Home
Products
Reticuline
| Product Name | Reticuline |
| Price: | Inquiry |
| Catalog No.: | CN01965 |
| CAS No.: | 485-19-8 |
| Molecular Formula: | C19H23NO4 |
| Molecular Weight: | 329.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Oil |
| Source: | The roots of Thalictrum foliolosum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1O)CC1N(C)CCc2c1cc(O)c(c2)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Reticuline, isolated from Litsea cubeba, shows anti-inflammatory effects through JAK2/STAT3 and NF-κB signaling pathways. Reticuline inhibits mRNA expressions of TNF-α, and IL-6 and reduces the phosphorylation levels of JAK2 and STAT3[1]. |
| Target | JAK2 STAT3 NF-κB |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 504.9±50.0 °C at 760 mmHg |
| Flash Point | 259.2±30.1 °C |
| Exact Mass | 329.162720 |
| PSA | 62.16000 |
| LogP | 2.09 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | -20?C Freezer |