Home
Products
Aristolochic acid C
| Product Name | Aristolochic acid C |
| Price: | $293 / 5mg |
| Catalog No.: | CN01217 |
| CAS No.: | 4849-90-5 |
| Molecular Formula: | C16H9NO7 |
| Molecular Weight: | 327.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Aristolochia debilis Sieb. et Zucc |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)c1c3OCOc3cc(c1c(c2)[N+](=O)[O-])C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aristolochic acid C is a derivative of Aristolochic acid. Aristolochic acid is a phospholipase A2 (PLA2) inhibitor, which disrupts cortical microtubule arrays and root growth in Arabidopsis[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 658.7±55.0 °C at 760 mmHg |
| Flash Point | 352.1±31.5 °C |
| Exact Mass | 327.037903 |
| PSA | 121.81000 |
| LogP | 2.76 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Storage condition | 2-8℃ |