Home
Products
Okanin
| Product Name | Okanin |
| Price: | $161 / 10mg |
| Catalog No.: | CN05635 |
| CAS No.: | 484-76-4 |
| Molecular Formula: | C15H12O6 |
| Molecular Weight: | 288.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The herbs of Bidens pilosa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1O)/C=C/C(=O)c1ccc(c(c1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Okanin, effective constituent of the flower tea Coreopsis tinctoria, attenuates LPS-induced microglial activation through inhibition of the TLR4/NF-κB signaling pathways[1]. |
| Target | TLR4 p65 |
| In Vitro | Okanin significantly inhibits LPS-induced TLR4 expression in BV-2 cells. Okanin inhibits the translocation of the NF-κB p65 subunit from the cytosol to the nucleus. Okanin significantly suppresses LPS-induced iNOS expression and also inhibites IL-6 and TNF-α production and mRNA expression in LPS-stimulated BV-2 cells[1]. |
| Density | 1.584g/cm3 |
| Boiling Point | 638ºC at 760mmHg |
| Flash Point | 353.7ºC |
| Exact Mass | 288.06300 |
| PSA | 118.22000 |
| LogP | 2.11070 |
| Vapour Pressure | 7.12E-17mmHg at 25°C |
| Storage condition | -20 °C |