Home
Products
Pongamol
| Product Name | Pongamol |
| Price: | Inquiry |
| Catalog No.: | CN03306 |
| CAS No.: | 484-33-3 |
| Molecular Formula: | C18H14O4 |
| Molecular Weight: | 294.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Tephrosia purpurea |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(ccc2c1cco2)C(=O)/C=C(/c1ccccc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pongamol (Lanceolatin C) is potent α-glucosidase inhibitor (IC50=103.5 μM) and has free-radical (DPPH) scavenging,antihyperglycemic, and antihyperglycemic activities[1]. |
| Density | 1.236 g/cm3 |
| Boiling Point | 448.7ºC at 760 mmHg |
| Flash Point | 218.7ºC |
| Exact Mass | 294.08900 |
| PSA | 56.51000 |
| LogP | 3.89710 |
| Vapour Pressure | 3.02E-10mmHg at 25°C |