Home
Products
Osthenol
| Product Name | Osthenol |
| Price: | $146 / 10mg |
| Catalog No.: | CN06055 |
| CAS No.: | 484-14-0 |
| Molecular Formula: | C14H14O3 |
| Molecular Weight: | 230.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Glehnia littoralis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)ccc2c1oc(=O)cc2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Osthenol (Ostenol), a prenylated coumarin isolated from the dried roots of Angelica pubescens, is selective, reversible, and competitive human monoamine oxidase-A (hMAO-A) inhibitor (Ki=0.26 µM). Osthenol potently inhibits recombinant hMAO-A with an IC50 of 0.74 µM and shows a high selectivity index for hMAO-A versus hMAO-B[1]. |
| Target | hMAO-A:0.26 μM (Ki) hMAO-A:0.74 μM (IC50) |
| Density | 1.203g/cm3 |
| Boiling Point | 422.8ºC at 760 mmHg |
| Flash Point | 184.1ºC |
| Exact Mass | 230.09400 |
| PSA | 50.44000 |
| LogP | 3.00730 |
| Vapour Pressure | 9.53E-08mmHg at 25°C |
| Storage condition | 2-8℃ |