Home
Products
Chrysophanol 1-O-glucoside
| Product Name | Chrysophanol 1-O-glucoside |
| Price: | $293 / 5mg |
| Catalog No.: | CN05937 |
| CAS No.: | 4839-60-5 |
| Molecular Formula: | C21H20O9 |
| Molecular Weight: | 416.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The roots of Rheum emodi |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc(C)cc3c2C(=O)c2c(C3=O)cccc2O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chrysophanein is a chrysophanol glycoside from leaves and roots of Aloe hijazensis. Chrysophanein shows a moderate cytotoxic activity against several carcinoma cells lines[1]. |
| Exact Mass | 416.11100 |
| PSA | 153.75000 |