Home
Products
Sphondin
| Product Name | Sphondin |
| Price: | Inquiry |
| Catalog No.: | CN06261 |
| CAS No.: | 483-66-9 |
| Molecular Formula: | C12H8O4 |
| Molecular Weight: | 216.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The fruits of Heracleum sibiricum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2ccc(=O)oc2c2c1occ2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sphondin, isolated from Heracleum laciniatum, possesses an inhibitory effect on IL-1β-induced increase in the level of COX-2 protein and PGE2 release in A549 cells[1]. |
| Target | COX-2 |
| In Vitro | Pretreatment of A549 cells with Sphondin (10-50 μM) concentration-dependently attenuates IL-1β-induced COX-2 protein expression and PGE2 release[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 413.0±45.0 °C at 760 mmHg |
| Flash Point | 203.6±28.7 °C |
| Exact Mass | 216.042252 |
| PSA | 52.58000 |
| LogP | 1.83 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |