Home
Products
(-)-Isocorypalmine
| Product Name | (-)-Isocorypalmine |
| Price: | $234 / 10mg |
| Catalog No.: | CN01097 |
| CAS No.: | 483-34-1 |
| Molecular Formula: | C20H23NO4 |
| Molecular Weight: | 341.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The tubers of Corydalis yanhusuo W. T. Wang. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCN3[C@H](c2cc1O)Cc1c(C3)c(OC)c(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Isocorypalmine, an alkaloid isolated from Corydalis chaerophylla, possesses antifungal activity[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 501.2±50.0 °C at 760 mmHg |
| Flash Point | 256.9±30.1 °C |
| Exact Mass | 341.162720 |
| PSA | 51.16000 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |