Home
Products
Cephaeline
| Product Name | Cephaeline |
| Price: | Inquiry |
| Catalog No.: | CN00737 |
| CAS No.: | 483-17-0 |
| Molecular Formula: | C28H38N2O4 |
| Molecular Weight: | 466.62 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Alangium lamarckii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@H]1CN2CCc3c([C@@H]2C[C@@H]1C[C@H]1NCCc2c1cc(OC)c(c2)O)cc(c(c3)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cephaeline is a phenolic alkaloid in Indian Ipecac roots. Cephaeline exhibits potent inhibition of both Zika virus (ZIKV) and Ebola virus (EBOV) infections[1][2]. |
| Density | 1.21g/cm3 |
| Boiling Point | 614ºC at 760mmHg |
| Flash Point | 325.1ºC |
| Exact Mass | 466.28300 |
| PSA | 63.19000 |
| LogP | 4.90710 |
| Vapour Pressure | 1.15E-15mmHg at 25°C |
| Storage condition | -20℃ |