Home
Products
Dihydroberberine
| Product Name | Dihydroberberine |
| Price: | Inquiry |
| Catalog No.: | CN01299 |
| CAS No.: | 483-15-8 |
| Molecular Formula: | C20H19NO4 |
| Molecular Weight: | 337.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The tubers of Corydalis decumbens (Thunb.) Pers. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc2c1CN1CCc3c(C1=C2)cc1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydroberberine inhibits human ether-a-go-go-related gene (hERG) channels and remarkably reduces heat shock protein 90 (Hsp90) expression and its interaction with hERG. Dihydroberberine has anti-inflammatory, anti-atherosclerotic, hypolipidemic and antitumor activities[1]. |
| Target | HSP90 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 557.8±50.0 °C at 760 mmHg |
| Flash Point | 170.7±27.3 °C |
| Exact Mass | 337.131409 |
| PSA | 40.16000 |
| LogP | 5.09 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8C |