Home
Products
Indigo
| Product Name | Indigo |
| Price: | $18 / 20mg |
| Catalog No.: | CN02112 |
| CAS No.: | 482-89-3 |
| Molecular Formula: | C16H10N2O2 |
| Molecular Weight: | 262.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The leaves of Isatis indigotica Fortune |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1c2ccccc2N=C1c1[nH]c2c(c1O)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Indigo is a deep and rich color dye for indole stain, isolated from the plant Indigofera tinctoria and related species[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 400.4±45.0 °C at 760 mmHg |
| Flash Point | 158.2±28.9 °C |
| Exact Mass | 262.074219 |
| PSA | 58.20000 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |