Home
Products
Dalbergin
| Product Name | Dalbergin |
| Price: | $146 / 5mg |
| Catalog No.: | CN06105 |
| CAS No.: | 482-83-7 |
| Molecular Formula: | C16H12O4 |
| Molecular Weight: | 268.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The heartwoods of Dalbergia sissoo. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2oc(=O)cc(c2cc1O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dalbergin is a composition of the extract from the Dalbergia Sissoo Linn. knot wood. Dalbergin demonstrats notable antioxidant ability[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 489.0±45.0 °C at 760 mmHg |
| Flash Point | 187.5±22.2 °C |
| Exact Mass | 268.073547 |
| PSA | 59.67000 |
| LogP | 3.34 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |