Home
Products
Nordalbergin
| Product Name | Nordalbergin |
| Price: | Inquiry |
| Catalog No.: | CN06061 |
| CAS No.: | 482-82-6 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The heartwoods of Dalbergia sissoo. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1oc2cc(O)c(cc2c(c1)c1ccccc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nordalbergin, a coumarin isolated from the wood bark of Dalbergia sissoo. Nordalbergin shows strong activity in the induction of differentiation of HL-60[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 522.4±50.0 °C at 760 mmHg |
| Flash Point | 205.2±23.6 °C |
| Exact Mass | 254.057907 |
| PSA | 70.67000 |
| LogP | 3.69 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8°C |