Home
Products
Isobergapten
| Product Name | Isobergapten |
| Price: | $176 / 10mg |
| Catalog No.: | CN06209 |
| CAS No.: | 482-48-4 |
| Molecular Formula: | C12H8O4 |
| Molecular Weight: | 216.19 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | White powder |
| Source: | The fruits of Citrus medica L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2occc2c2c1ccc(=O)o2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isobergapten is an allelopathic inhibitor isolated from seeds of Hevacleum laciniatum[1]. |
| Density | 1.368 |
| Boiling Point | 412.4±45.0 °C at 760 mmHg |
| Flash Point | 203.2±28.7 °C |
| Exact Mass | 216.042252 |
| PSA | 52.58000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Storage condition | 2-8C |