Home
Products
Hyperoside
| Product Name | Hyperoside |
| Price: | $42 / 20mg |
| Catalog No.: | CN05346 |
| CAS No.: | 482-36-0 |
| Molecular Formula: | C21H20O12 |
| Molecular Weight: | 464.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Hypericum perforatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hyperoside, a natural flavonoid, isolated from Camptotheca acuminate, possesses antifungal, anti-inflammatory, anti-viral, anti-oxidative and anti-apoptotic activities[1]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 872.6±65.0 °C at 760 mmHg |
| Flash Point | 307.5±27.8 °C |
| Exact Mass | 464.095490 |
| PSA | 210.51000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |