Home
Products
Byakangelicin
| Product Name | Byakangelicin |
| Price: | $103 / 10mg |
| Catalog No.: | CN06280 |
| CAS No.: | 482-25-7 |
| Molecular Formula: | C17H18O7 |
| Molecular Weight: | 334.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica dahurica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2ccoc2c(c2c1ccc(=O)o2)OC[C@H](C(O)(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Byakangelicin, one of the active compounds found in the roots of Angelica gigas, can serve as a modulator to improve brain accumulation of diverse active compounds (Umb, Cur, and Dox) and enhance therapeutic effects[1]. Byakangelicin is likely to increase the expression of all PXR target genes (such as MDR1) and induce a wide range of drug-drug interactions. Byakangelicin can inhibit the effects of sex hormones, it may increase the catabolism of endogenous hormones[2]. |
| Target | PXR[2] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 571.5±50.0 °C at 760 mmHg |
| Flash Point | 299.4±30.1 °C |
| Exact Mass | 334.105255 |
| PSA | 102.27000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | ?20°C |