Home
Products
Cepharanthine
| Product Name | Cepharanthine |
| Price: | $23 / 20mg |
| Catalog No.: | CN02031 |
| CAS No.: | 481-49-2 |
| Molecular Formula: | C37H38N2O6 |
| Molecular Weight: | 606.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Stephania japonica (Thunb.) Miers |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCN(C3c2cc1Oc1c2c(CCN(C2Cc2ccc(Oc4cc(C3)ccc4OC)cc2)C)cc2c1OCO2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cepharanthine, an alkaloid derived from Stephania cepharantha Hayata, with possesses anti-inflammatory and antioxidative activities[1][2][3]. Cepharanthine attenuates muscle and kidney injuries induced by limb ischemia/reperfusion (I/R)[3]. Cepharanthine induces autophagy, apoptosis and cell cycle arrest in breast cancer cells[4]. Cepharanthine inhibits the HIV-1 entry process by reducing plasma membrane fluidity[5]. |
| Density | 1.2±0.1 g/cm3 |
| Exact Mass | 606.273010 |
| PSA | 61.86000 |
| LogP | 5.23 |