Home
Products
5-alpha-Cholestane
| Product Name | 5-alpha-Cholestane |
| Price: | Inquiry |
| Catalog No.: | CN02259 |
| CAS No.: | 481-21-0 |
| Molecular Formula: | C27H48 |
| Molecular Weight: | 372.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The leaves of Olea europaea L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CC[C@@H]2[C@]1(C)CCCC2)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 440.9±12.0 °C at 760 mmHg |
| Flash Point | 210.3±13.1 °C |
| Exact Mass | 372.375610 |
| LogP | 12.26 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Storage condition | room temp |