Home
Products
alpha-Spinasterol
| Product Name | alpha-Spinasterol |
| Price: | $204 / 5mg |
| Catalog No.: | CN02515 |
| CAS No.: | 481-18-5 |
| Molecular Formula: | C29H48O |
| Molecular Weight: | 412.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Bupleurum chinense DC. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@@H](C(C)C)/C=C/[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1C2=CC[C@@H]2[C@]1(C)CC[C@@H](C2)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | α-Spinasterol, isolated from Spinacia oleracea, has antibacterial activity[1]. α-Spinasterol is a transient receptor potential vanilloid 1 (TRPV1) antagonist, has anti-inflammatory, antidepressant, antioxidant and antinociceptive effects. α-Spinasterol inhibits COX-1 andCOX-2 activities with IC50 values of 16.17 μM and 7.76 μM, respectively[2]. |
| Target | COX-1:16.17 μM (IC50) COX-2:7.76 μM (IC50) TRPV1 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 500.0±44.0 °C at 760 mmHg |
| Flash Point | 219.1±20.7 °C |
| Exact Mass | 412.370514 |
| PSA | 20.23000 |
| LogP | 10.13 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | 2-8℃ |