Home
Products
Alpha-Santonin
| Product Name | Alpha-Santonin |
| Price: | $23 / 20mg |
| Catalog No.: | CN09078 |
| CAS No.: | 481-06-1 |
| Molecular Formula: | C15H18O3 |
| Molecular Weight: | 246.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Artemisia absynthium L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1C(=O)OC2C1CCC1(C2=C(C)C(=O)C=C1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Santonin is an active principle of the plant Artemisia cina, which is formely used to treat worms[1]. |
| Density | 1.18g/cm3 |
| Boiling Point | 423.4ºC at 760mmHg |
| Flash Point | 189.7ºC |
| Exact Mass | 246.12600 |
| PSA | 43.37000 |
| LogP | 2.41960 |
| Vapour Pressure | 2.24E-07mmHg at 25°C |
| Storage condition | 2-8°C |