Home
Products
Acacetin
| Product Name | Acacetin |
| Price: | $92 / 20mg |
| Catalog No.: | CN05349 |
| CAS No.: | 480-44-4 |
| Molecular Formula: | C16H12O5 |
| Molecular Weight: | 284.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The barks of Acacia farnesiana. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(cc2O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1) Natural acacetin was a 4.0-fold and 5.5-fold more potent inhibitor of BACE-1 than oleanolic acid and maslinic acid, respectively.[1]2) Acacetin significantly suppressed the photoreceptor collapse. [1]3) Acacetin significantly reduces the Aβ levels by interfering with human APP proteolytic processing and BACE-1 expression. [1]4) Acacetin inhibited the generation of the APP-CTF by affecting APP cleavage. [1]5) Acacetin prolongs lifespan of significantly in the dose dependent manner. Acacetin(25 uM) had the greatest effect on longevity, extending mean lifespan significantly by 27.31% at 25 uM concentration |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 518.6±50.0 °C at 760 mmHg |
| Flash Point | 198.3±23.6 °C |
| Exact Mass | 284.068481 |
| PSA | 79.90000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8°C |