Home
Products
Pinostrobin
| Product Name | Pinostrobin |
| Price: | $146 / 5mg |
| Catalog No.: | CN05354 |
| CAS No.: | 480-37-5 |
| Molecular Formula: | C16H14O4 |
| Molecular Weight: | 270.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Cajanus cajan |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2OC(CC(=O)c2c(c1)O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pinostrobin is a flavonoid can be found in many plants, and has anti-oxidant, anti-inflammatory, anti-cancer and neuroprotective properties. Pinostrobin is a potent PCSK9 inhibitor and inhibits the catalytic activity of PCSK9. Pinostrobin is a promising agent for cholesterol regulation and lipid management[1]. |
| Target | IC50: PCSK9[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 494.9±45.0 °C at 760 mmHg |
| Flash Point | 188.8±22.2 °C |
| Exact Mass | 270.089203 |
| PSA | 55.76000 |
| LogP | 4.11 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |