Home
Products
Eugenin
| Product Name | Eugenin |
| Price: | Inquiry |
| Catalog No.: | CN03723 |
| CAS No.: | 480-34-2 |
| Molecular Formula: | C11H10O4 |
| Molecular Weight: | 206.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rootbarks of Schumanniophyton magnificum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(cc2=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eugenin is a chromone isolated from Peucedanum japonicum, with potent antiplatelet aggregation activity[1]. |
| Density | 1.309g/cm3 |
| Boiling Point | 389.2ºC at 760 mmHg |
| Flash Point | 157.2ºC |
| Exact Mass | 206.05800 |
| PSA | 59.67000 |
| LogP | 1.81560 |
| Vapour Pressure | 1.29E-06mmHg at 25°C |
| Storage condition | 2-8°C |