Home
Products
Mellein
| Product Name | Mellein |
| Price: | Inquiry |
| Catalog No.: | CN06158 |
| CAS No.: | 480-33-1 |
| Molecular Formula: | C10H10O3 |
| Molecular Weight: | 178.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Goniothalamus griffithii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1Cc2cccc(c2C(=O)O1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Mellein is an antibiotic isolated from culture fluids of this Aspergillus[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 392.7±42.0 °C at 760 mmHg |
| Flash Point | 181.3±20.7 °C |
| Exact Mass | 178.062988 |
| PSA | 46.53000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |