Home
Products
Morin
| Product Name | Morin |
| Price: | $46 / 20mg |
| Catalog No.: | CN05471 |
| CAS No.: | 480-16-0 |
| Molecular Formula: | C15H10O7 |
| Molecular Weight: | 302.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The root bark of Morus alba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(c(c1)O)c1oc2cc(O)cc(c2c(=O)c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Morin, a plant-derived flavonoid, possesses low antioxidant activity. Morin is a fluorescing chelating agent used in aluminum speciation[1][2]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 645.5±55.0 °C at 760 mmHg |
| Flash Point | 249.3±25.0 °C |
| Exact Mass | 302.042664 |
| PSA | 131.36000 |
| LogP | 1.61 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |