Home
Products
Artemetin
| Product Name | Artemetin |
| Price: | $117 / 20mg |
| Catalog No.: | CN05361 |
| CAS No.: | 479-90-3 |
| Molecular Formula: | C20H20O8 |
| Molecular Weight: | 388.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Achillea millefolium L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1OC)c1oc2cc(OC)c(c(c2c(=O)c1OC)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Artemitin is a flavonol found in Laggera pterodonta (DC.) Benth., with antioxidative, anti-inflammatory, and antiviral activity[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 588.8±50.0 °C at 760 mmHg |
| Flash Point | 208.9±23.6 °C |
| Exact Mass | 388.115814 |
| PSA | 96.59000 |
| LogP | 2.55 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2-8℃ |