Home
Products
Cotoin
| Product Name | Cotoin |
| Price: | $293 / 10mg |
| Catalog No.: | CN05820 |
| CAS No.: | 479-21-0 |
| Molecular Formula: | C14H12O4 |
| Molecular Weight: | 244.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Garcinia cowa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c(c(c1)O)C(=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cotoin is a natural product isolated from the stem bark of Garcinia virgate[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 402.2±45.0 °C at 760 mmHg |
| Flash Point | 153.3±22.2 °C |
| Exact Mass | 244.073563 |
| PSA | 66.76000 |
| LogP | 4.07 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |