Home
Products
Atranorin
| Product Name | Atranorin |
| Price: | Inquiry |
| Catalog No.: | CN04026 |
| CAS No.: | 479-20-9 |
| Molecular Formula: | C19H18O8 |
| Molecular Weight: | 374.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Parmelia tinctorum Despr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)c1c(C)cc(c(c1O)C)OC(=O)c1c(C)cc(c(c1O)C=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Atranorin is a lichen secondary metabolite. Atranorin inhibits lung cancer cell motility and tumorigenesis by affecting AP-1, Wnt, and STAT signaling and suppressing RhoGTPase activity[1][2]. |
| Target | RhoGTPase[1] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 535.7±50.0 °C at 760 mmHg |
| Flash Point | 189.3±23.6 °C |
| Exact Mass | 374.100159 |
| PSA | 130.36000 |
| LogP | 6.14 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |