Home
Products
Nobiletin
| Product Name | Nobiletin |
| Price: | $28 / 20mg |
| Catalog No.: | CN05362 |
| CAS No.: | 478-01-3 |
| Molecular Formula: | C21H22O8 |
| Molecular Weight: | 402.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The peels of Citrus nobilis Lour. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1OC)c1cc(=O)c2c(o1)c(OC)c(c(c2OC)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nobiletin is a citrus flavonoid with anti-inflammatory, anti-cancer, cholesterol lowering, memory protection activities. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 587.9±50.0 °C at 760 mmHg |
| Flash Point | 256.5±30.2 °C |
| Exact Mass | 402.131470 |
| PSA | 85.59000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | -20°C |