Home
Products
Obtusifolin
| Product Name | Obtusifolin |
| Price: | $146 / 10mg |
| Catalog No.: | CN05977 |
| CAS No.: | 477-85-0 |
| Molecular Formula: | C16H12O5 |
| Molecular Weight: | 284.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The seeds of Cassia obtusifolia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2c(cc(c1O)C)C(=O)c1c(C2=O)c(O)ccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Obtusifolin, isolated from the seeds of Cassia obtusifolia, regulates the gene expression and production of MUC5AC mucin in airway epithelial cells via inhibiting NF-kB pathway[1]. Obtusifolin suppresses phthalate esters-induced breast cancer bone metastasis by targeting parathyroid hormone-related protein[2]. |
| Target | NF-κB |
| In Vitro | Obtusifolin (1, 10, 100 μM) inhibits MUC5AC gene expression induced by EGF, PMA, or TNF-α in NCI-H292 cells[1]. |
| Density | 1.448±0.06 g/cm3 |
| Boiling Point | 528.0±50.0 °C at 760 mmHg |
| Flash Point | 202.2±23.6 °C |
| Exact Mass | 284.068481 |
| PSA | 83.83000 |
| LogP | 4.18 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | -20℃ |