Home
Products
Corydine
| Product Name | Corydine |
| Price: | Inquiry |
| Catalog No.: | CN01214 |
| CAS No.: | 476-69-7 |
| Molecular Formula: | C20H23NO4 |
| Molecular Weight: | 341.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Solid |
| Source: | The tubers of Corydalis tuberosa DC. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCN(C3c2c(c1O)c1c(C3)ccc(c1OC)OC)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Corydine is a naturally occurring alkaloid which can be extracted from plants such as Croton echinocarpus leaves. Corydine is efficient on inhibiting reverse transcriptase (RT) activity with an IC50 of 356.8 μg/mL. Corydine displays significant in vitro anti-HIV potential, inhibiting 40% of the HIV-1 reverse transcriptase enzyme activity at a concentration of 450 μg/mL of Corydine[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 505.7±50.0 °C at 760 mmHg |
| Flash Point | 259.7±30.1 °C |
| Exact Mass | 341.162720 |
| PSA | 51.16000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |