Home
Products
Aristolochic acid B
| Product Name | Aristolochic acid B |
| Price: | $234 / 10mg |
| Catalog No.: | CN02199 |
| CAS No.: | 475-80-9 |
| Molecular Formula: | C16H9NO6 |
| Molecular Weight: | 311.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Aristolochia debilis Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | [O-][N+](=O)c1cc2ccccc2c2c1c(cc1c2OCO1)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aristolochic acid B is one of the major components of Aristolochic acids (AA) which are natural products derived from taxa in the Aristolochiaceae. Aristolochic acid is known to be a potent mutagen and carcinogen. Aristolochic acid B showes more carcinogenic risk than Aristolochic acid A in vivo[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 592.2±50.0 °C at 760 mmHg |
| Flash Point | 311.9±30.1 °C |
| Exact Mass | 311.042999 |
| PSA | 101.58000 |
| LogP | 3.50 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |